About 3-chloro-N,N-diphenylaniline
3-chloro-N,N-diphenylaniline (PubChem CID 2189355) has the molecular formula C18H14ClN
and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-chloro-N,N-diphenylaniline.
Molecular Properties
| Compound Name | 3-chloro-N,N-diphenylaniline |
| PubChem CID | 2189355 |
| Molecular Formula | C18H14ClN |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-chloro-N,N-diphenylaniline |
| SMILES | Clc1cccc(N(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C18H14ClN/c19-15-8-7-13-18(14-15)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H |
| InChIKey | NMHRZASZFUNUJD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-N,N-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N-diphenylaniline?
The IUPAC name of 3-chloro-N,N-diphenylaniline (CID 2189355) is 3-chloro-N,N-diphenylaniline.
What is the SMILES notation for 3-chloro-N,N-diphenylaniline?
The canonical SMILES for 3-chloro-N,N-diphenylaniline is Clc1cccc(N(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 3-chloro-N,N-diphenylaniline?
The InChIKey is NMHRZASZFUNUJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN/c19-15-8-7-13-18(14-15)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H.
What are the key properties of 3-chloro-N,N-diphenylaniline?
3-chloro-N,N-diphenylaniline has a molecular weight of 279.77 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N-diphenylaniline is sourced from PubChem (CID 2189355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).