About (2-benzyl-1,3-dioxolan-4-yl)methanol
(2-benzyl-1,3-dioxolan-4-yl)methanol (PubChem CID 21895) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is (2-benzyl-1,3-dioxolan-4-yl)methanol.
Molecular Properties
| Compound Name | (2-benzyl-1,3-dioxolan-4-yl)methanol |
| PubChem CID | 21895 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (2-benzyl-1,3-dioxolan-4-yl)methanol |
| SMILES | OCC1COC(Cc2ccccc2)O1 |
| InChI | InChI=1S/C11H14O3/c12-7-10-8-13-11(14-10)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| InChIKey | ZPENOSKWEKGDCX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-benzyl-1,3-dioxolan-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzyl-1,3-dioxolan-4-yl)methanol?
The IUPAC name of (2-benzyl-1,3-dioxolan-4-yl)methanol (CID 21895) is (2-benzyl-1,3-dioxolan-4-yl)methanol.
What is the SMILES notation for (2-benzyl-1,3-dioxolan-4-yl)methanol?
The canonical SMILES for (2-benzyl-1,3-dioxolan-4-yl)methanol is OCC1COC(Cc2ccccc2)O1.
What is the InChIKey of (2-benzyl-1,3-dioxolan-4-yl)methanol?
The InChIKey is ZPENOSKWEKGDCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c12-7-10-8-13-11(14-10)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2.
What are the key properties of (2-benzyl-1,3-dioxolan-4-yl)methanol?
(2-benzyl-1,3-dioxolan-4-yl)methanol has a molecular weight of 194.23 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzyl-1,3-dioxolan-4-yl)methanol is sourced from PubChem (CID 21895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).