C6H7F7N2O — CID 2189505
2,2,3,3,4,4,4-heptafluoro-N',N'-dimethylbutanehydrazide (PubChem CID 2189505) has the molecular formula C6H7F7N2O and a molecular weight of 256.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N',N'-dimethylbutanehydrazide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N',N'-dimethylbutanehydrazide |
|---|---|
| PubChem CID | 2189505 |
| Molecular Formula | C6H7F7N2O |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N',N'-dimethylbutanehydrazide |
| SMILES | CN(C)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7N2O/c1-15(2)14-3(16)4(7,8)5(9,10)6(11,12)13/h1-2H3,(H,14,16) |
| InChIKey | VWXQGGUQHQYIOI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|