About 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate
3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate (PubChem CID 2190438) has the molecular formula C20H19N3O4
and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate |
| PubChem CID | 2190438 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate |
| SMILES | CCOC(=O)c1cnc2c(C(=O)OC)cccc2c1NCc1cccnc1 |
| InChI | InChI=1S/C20H19N3O4/c1-3-27-20(25)16-12-23-17-14(7-4-8-15(17)19(24)26-2)18(16)22-11-13-6-5-9-21-10-13/h4-10,12H,3,11H2,1-2H3,(H,22,23) |
| InChIKey | DLGXOKQNYPYKOE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate?
The IUPAC name of 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate (CID 2190438) is 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate?
The canonical SMILES for 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate is CCOC(=O)c1cnc2c(C(=O)OC)cccc2c1NCc1cccnc1.
What is the InChIKey of 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate?
The InChIKey is DLGXOKQNYPYKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O4/c1-3-27-20(25)16-12-23-17-14(7-4-8-15(17)19(24)26-2)18(16)22-11-13-6-5-9-21-10-13/h4-10,12H,3,11H2,1-2H3,(H,22,23).
What are the key properties of 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate?
3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate has a molecular weight of 365.39 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 8-O-methyl 4-(pyridin-3-ylmethylamino)quinoline-3,8-dicarboxylate is sourced from PubChem (CID 2190438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).