C11H22O3 — CID 21905
(2-heptan-3-yl-1,3-dioxolan-4-yl)methanol (PubChem CID 21905) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is (2-heptan-3-yl-1,3-dioxolan-4-yl)methanol.
| Compound Name | (2-heptan-3-yl-1,3-dioxolan-4-yl)methanol |
|---|---|
| PubChem CID | 21905 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | (2-heptan-3-yl-1,3-dioxolan-4-yl)methanol |
| SMILES | CCCCC(CC)C1OCC(CO)O1 |
| InChI | InChI=1S/C11H22O3/c1-3-5-6-9(4-2)11-13-8-10(7-12)14-11/h9-12H,3-8H2,1-2H3 |
| InChIKey | VNMRSUHVTDURNJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |