C12H12N2O3S2 — CID 2190820
methyl 2-[(5Z)-3-methyl-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-1-yl]acetate (PubChem CID 2190820) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is methyl 2-[(5Z)-3-methyl-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-3-methyl-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 2190820 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | methyl 2-[(5Z)-3-methyl-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=S)N(C)C(=O)/C1=C/c1cccs1 |
| InChI | InChI=1S/C12H12N2O3S2/c1-13-11(16)9(6-8-4-3-5-19-8)14(12(13)18)7-10(15)17-2/h3-6H,7H2,1-2H3/b9-6- |
| InChIKey | LGTOSFDVWHALAM-TWGQIWQCSA-N |
| XLogP | 1.32 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|