C21H21N3OS — CID 2192131
2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 2192131) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 2192131 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | Cc1cc(-c2ccccc2)nc(SCC(=O)N[C@H](C)c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N3OS/c1-15-13-19(18-11-7-4-8-12-18)24-21(22-15)26-14-20(25)23-16(2)17-9-5-3-6-10-17/h3-13,16H,14H2,1-2H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | PKMVXHYFRZAESV-MRXNPFEDSA-N |
| XLogP | 4.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |