About 1H-indole-3-carboxamide
1H-indole-3-carboxamide (PubChem CID 2192542) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | 1H-indole-3-carboxamide |
| PubChem CID | 2192542 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1H-indole-3-carboxamide |
| SMILES | NC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H8N2O/c10-9(12)7-5-11-8-4-2-1-3-6(7)8/h1-5,11H,(H2,10,12) |
| InChIKey | LSGKMZLPZFPAIN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-3-carboxamide?
The IUPAC name of 1H-indole-3-carboxamide (CID 2192542) is 1H-indole-3-carboxamide.
What is the SMILES notation for 1H-indole-3-carboxamide?
The canonical SMILES for 1H-indole-3-carboxamide is NC(=O)c1c[nH]c2ccccc12.
What is the InChIKey of 1H-indole-3-carboxamide?
The InChIKey is LSGKMZLPZFPAIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c10-9(12)7-5-11-8-4-2-1-3-6(7)8/h1-5,11H,(H2,10,12).
What are the key properties of 1H-indole-3-carboxamide?
1H-indole-3-carboxamide has a molecular weight of 160.18 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-3-carboxamide is sourced from PubChem (CID 2192542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).