About 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole
2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole (PubChem CID 21928646) has the molecular formula C22H16FN3O
and a molecular weight of 357.40 g/mol. Its IUPAC name is 2-[6-(3-fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole |
| PubChem CID | 21928646 |
| Molecular Formula | C22H16FN3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[6-(3-fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole |
| SMILES | C1C2=C(C=CC1(C3=CC=CC=C3)C4=CC(=CC=C4)F)C(=NN2)C5=NC=CO5 |
| InChI | InChI=1S/C22H16FN3O/c23-17-8-4-7-16(13-17)22(15-5-2-1-3-6-15)10-9-18-19(14-22)25-26-20(18)21-24-11-12-27-21/h1-13H,14H2,(H,25,26) |
| InChIKey | SVCKSGBDWSTKMK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | 552 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole?
The IUPAC name of 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole (CID 21928646) is 2-[6-(3-fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole.
What is the SMILES notation for 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole?
The canonical SMILES for 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole is C1C2=C(C=CC1(C3=CC=CC=C3)C4=CC(=CC=C4)F)C(=NN2)C5=NC=CO5.
What is the InChIKey of 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole?
The InChIKey is SVCKSGBDWSTKMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16FN3O/c23-17-8-4-7-16(13-17)22(15-5-2-1-3-6-15)10-9-18-19(14-22)25-26-20(18)21-24-11-12-27-21/h1-13H,14H2,(H,25,26).
What are the key properties of 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole?
2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole has a molecular weight of 357.40 g/mol, XLogP of 4.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(3-Fluorophenyl)-6-phenyl-1,7-dihydroindazol-3-yl]-1,3-oxazole is sourced from PubChem (CID 21928646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).