C18H13N3OS2 — CID 21928882
5-[6,6-Di(thiophen-3-yl)-1,7-dihydroindazol-3-yl]-1,3-oxazole (PubChem CID 21928882) has the molecular formula C18H13N3OS2 and a molecular weight of 351.40 g/mol. Its IUPAC name is 5-[6,6-di(thiophen-3-yl)-1,7-dihydroindazol-3-yl]-1,3-oxazole.
| Compound Name | 5-[6,6-Di(thiophen-3-yl)-1,7-dihydroindazol-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 21928882 |
| Molecular Formula | C18H13N3OS2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 5-[6,6-di(thiophen-3-yl)-1,7-dihydroindazol-3-yl]-1,3-oxazole |
| SMILES | C1C2=C(C=CC1(C3=CSC=C3)C4=CSC=C4)C(=NN2)C5=CN=CO5 |
| InChI | InChI=1S/C18H13N3OS2/c1-4-18(12-2-5-23-9-12,13-3-6-24-10-13)7-15-14(1)17(21-20-15)16-8-19-11-22-16/h1-6,8-11H,7H2,(H,20,21) |
| InChIKey | BUUJEGVLDNXBTG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | 487 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |