About N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide
N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide (PubChem CID 2193317) has the molecular formula C13H14Cl2N2O2
and a molecular weight of 301.17 g/mol. Its IUPAC name is N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide |
| PubChem CID | 2193317 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C13H14Cl2N2O2/c14-8-5-9(15)7-11(6-8)17-13(19)12(18)16-10-3-1-2-4-10/h5-7,10H,1-4H2,(H,16,18)(H,17,19) |
| InChIKey | JGVXDBLVBPZXOR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide?
The IUPAC name of N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide (CID 2193317) is N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide.
What is the SMILES notation for N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide?
The canonical SMILES for N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide is O=C(Nc1cc(Cl)cc(Cl)c1)C(=O)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide?
The InChIKey is JGVXDBLVBPZXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2O2/c14-8-5-9(15)7-11(6-8)17-13(19)12(18)16-10-3-1-2-4-10/h5-7,10H,1-4H2,(H,16,18)(H,17,19).
What are the key properties of N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide?
N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide has a molecular weight of 301.17 g/mol, XLogP of 2.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-N'-(3,5-dichlorophenyl)oxamide is sourced from PubChem (CID 2193317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).