C10H9NO3 — CID 2193822
3-Buten-2-one, 3-nitro-4-phenyl-, (E)- (PubChem CID 2193822) has the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. Its IUPAC name is (Z)-3-nitro-4-phenylbut-3-en-2-one.
| Compound Name | 3-Buten-2-one, 3-nitro-4-phenyl-, (E)- |
|---|---|
| PubChem CID | 2193822 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (Z)-3-nitro-4-phenylbut-3-en-2-one |
| SMILES | CC(=O)/C(=C/C1=CC=CC=C1)/[N+](=O)[O-] |
| InChI | InChI=1S/C10H9NO3/c1-8(12)10(11(13)14)7-9-5-3-2-4-6-9/h2-7H,1H3/b10-7- |
| InChIKey | OYRPMZZLRMIPOM-YFHOEESVSA-N |
| XLogP | 2.10 |
| TPSA | 62.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 259 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|