C7H6N4O — CID 21939
5-pyridin-2-yl-1,3,4-oxadiazol-2-amine (PubChem CID 21939) has the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. Its IUPAC name is 5-pyridin-2-yl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-pyridin-2-yl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 21939 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 5-pyridin-2-yl-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C7H6N4O/c8-7-11-10-6(12-7)5-3-1-2-4-9-5/h1-4H,(H2,8,11) |
| InChIKey | HXXADNULCQWUAF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |