C24H18F6N2O2 — CID 2194300
2,2,2-trifluoro-1-[1-[4-[3-(2,2,2-trifluoroacetyl)indol-1-yl]butyl]indol-3-yl]ethanone (PubChem CID 2194300) has the molecular formula C24H18F6N2O2 and a molecular weight of 480.41 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-[4-[3-(2,2,2-trifluoroacetyl)indol-1-yl]butyl]indol-3-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[1-[4-[3-(2,2,2-trifluoroacetyl)indol-1-yl]butyl]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 2194300 |
| Molecular Formula | C24H18F6N2O2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-[4-[3-(2,2,2-trifluoroacetyl)indol-1-yl]butyl]indol-3-yl]ethanone |
| SMILES | O=C(c1cn(CCCCn2cc(C(=O)C(F)(F)F)c3ccccc32)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C24H18F6N2O2/c25-23(26,27)21(33)17-13-31(19-9-3-1-7-15(17)19)11-5-6-12-32-14-18(22(34)24(28,29)30)16-8-2-4-10-20(16)32/h1-4,7-10,13-14H,5-6,11-12H2 |
| InChIKey | GIMSBUVDPSQWRB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|