About Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate
Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate (PubChem CID 21949260) has the molecular formula C9H17NO4S
and a molecular weight of 235.30 g/mol. Its IUPAC name is tert-butyl 1,1-dioxo-1,4-thiazinane-4-carboxylate.
Analyze Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate?
The IUPAC name of Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate (CID 21949260) is tert-butyl 1,1-dioxo-1,4-thiazinane-4-carboxylate.
What is the SMILES notation for Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate?
The canonical SMILES for Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate is CC(C)(C)OC(=O)N1CCS(=O)(=O)CC1.
What is the InChIKey of Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate?
The InChIKey is UPIBPNFZLMUGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4S/c1-9(2,3)14-8(11)10-4-6-15(12,13)7-5-10/h4-7H2,1-3H3.
What are the key properties of Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate?
Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate has a molecular weight of 235.30 g/mol, XLogP of 0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Tert-butyl 1,1-dioxo-1lambda6-thiomorpholine-4-carboxylate is sourced from PubChem (CID 21949260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).