C8H8F7NO3 — CID 2195133
2,2,3,3-tetrafluoro-1-morpholin-4-yl-3-(trifluoromethoxy)propan-1-one (PubChem CID 2195133) has the molecular formula C8H8F7NO3 and a molecular weight of 299.14 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-morpholin-4-yl-3-(trifluoromethoxy)propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-morpholin-4-yl-3-(trifluoromethoxy)propan-1-one |
|---|---|
| PubChem CID | 2195133 |
| Molecular Formula | C8H8F7NO3 |
| Molecular Weight | 299.14 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-morpholin-4-yl-3-(trifluoromethoxy)propan-1-one |
| SMILES | O=C(N1CCOCC1)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C8H8F7NO3/c9-6(10,7(11,12)19-8(13,14)15)5(17)16-1-3-18-4-2-16/h1-4H2 |
| InChIKey | IKCOHULDBGRMSR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|