C9H8F9NOS — CID 2195134
2,2,3,3,4,4,5,5,5-nonafluoro-1-thiomorpholin-4-ylpentan-1-one (PubChem CID 2195134) has the molecular formula C9H8F9NOS and a molecular weight of 349.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-1-thiomorpholin-4-ylpentan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-thiomorpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 2195134 |
| Molecular Formula | C9H8F9NOS |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-thiomorpholin-4-ylpentan-1-one |
| SMILES | O=C(N1CCSCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F9NOS/c10-6(11,5(20)19-1-3-21-4-2-19)7(12,13)8(14,15)9(16,17)18/h1-4H2 |
| InChIKey | ZMMIKRWVSDYOTL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|