About (3S)-3-acetamidononanoic acid
(3S)-3-acetamidononanoic acid (PubChem CID 2195186) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is (3S)-3-acetamidononanoic acid.
Molecular Properties
| Compound Name | (3S)-3-acetamidononanoic acid |
| PubChem CID | 2195186 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (3S)-3-acetamidononanoic acid |
| SMILES | CCCCCC[C@@H](CC(=O)O)NC(C)=O |
| InChI | InChI=1S/C11H21NO3/c1-3-4-5-6-7-10(8-11(14)15)12-9(2)13/h10H,3-8H2,1-2H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChIKey | VMIOCPMZZAXBSE-JTQLQIEISA-N |
| XLogP | 1.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-acetamidononanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-acetamidononanoic acid?
The IUPAC name of (3S)-3-acetamidononanoic acid (CID 2195186) is (3S)-3-acetamidononanoic acid.
What is the SMILES notation for (3S)-3-acetamidononanoic acid?
The canonical SMILES for (3S)-3-acetamidononanoic acid is CCCCCC[C@@H](CC(=O)O)NC(C)=O.
What is the InChIKey of (3S)-3-acetamidononanoic acid?
The InChIKey is VMIOCPMZZAXBSE-JTQLQIEISA-N. The full InChI is InChI=1S/C11H21NO3/c1-3-4-5-6-7-10(8-11(14)15)12-9(2)13/h10H,3-8H2,1-2H3,(H,12,13)(H,14,15)/t10-/m0/s1.
What are the key properties of (3S)-3-acetamidononanoic acid?
(3S)-3-acetamidononanoic acid has a molecular weight of 215.29 g/mol, XLogP of 1.94, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-acetamidononanoic acid is sourced from PubChem (CID 2195186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).