C15H19BrClNO — CID 2195412
3-(4-bromo-2-chlorophenoxy)-N,N-bis(prop-2-enyl)propan-1-amine (PubChem CID 2195412) has the molecular formula C15H19BrClNO and a molecular weight of 344.68 g/mol. Its IUPAC name is 3-(4-bromo-2-chlorophenoxy)-N,N-bis(prop-2-enyl)propan-1-amine.
| Compound Name | 3-(4-bromo-2-chlorophenoxy)-N,N-bis(prop-2-enyl)propan-1-amine |
|---|---|
| PubChem CID | 2195412 |
| Molecular Formula | C15H19BrClNO |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-(4-bromo-2-chlorophenoxy)-N,N-bis(prop-2-enyl)propan-1-amine |
| SMILES | C=CCN(CC=C)CCCOc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H19BrClNO/c1-3-8-18(9-4-2)10-5-11-19-15-7-6-13(16)12-14(15)17/h3-4,6-7,12H,1-2,5,8-11H2 |
| InChIKey | PXRCALSAQGFTNU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|