C18H18BrN3O3 — CID 2195691
N-[2-[2-[1-(4-bromophenyl)ethenyl]hydrazinyl]-2-oxoethyl]-2-methoxybenzamide (PubChem CID 2195691) has the molecular formula C18H18BrN3O3 and a molecular weight of 404.26 g/mol. Its IUPAC name is N-[2-[2-[1-(4-bromophenyl)ethenyl]hydrazinyl]-2-oxoethyl]-2-methoxybenzamide.
| Compound Name | N-[2-[2-[1-(4-bromophenyl)ethenyl]hydrazinyl]-2-oxoethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 2195691 |
| Molecular Formula | C18H18BrN3O3 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-[2-[2-[1-(4-bromophenyl)ethenyl]hydrazinyl]-2-oxoethyl]-2-methoxybenzamide |
| SMILES | C=C(NNC(=O)CNC(=O)c1ccccc1OC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrN3O3/c1-12(13-7-9-14(19)10-8-13)21-22-17(23)11-20-18(24)15-5-3-4-6-16(15)25-2/h3-10,21H,1,11H2,2H3,(H,20,24)(H,22,23) |
| InChIKey | OVVRJKWVEZNFNC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|