C13H15N5OS — CID 2196874
4-amino-1-butylsulfanyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 2196874) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-amino-1-butylsulfanyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-amino-1-butylsulfanyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 2196874 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-amino-1-butylsulfanyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCCCSc1nnc2n(N)c(=O)c3ccccc3n12 |
| InChI | InChI=1S/C13H15N5OS/c1-2-3-8-20-13-16-15-12-17(13)10-7-5-4-6-9(10)11(19)18(12)14/h4-7H,2-3,8,14H2,1H3 |
| InChIKey | PHFHSJYRYIZVLC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|