About 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide
2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide (PubChem CID 2197130) has the molecular formula C23H22N4O3S
and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide |
| PubChem CID | 2197130 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide |
| SMILES | C=CCSc1nc(N)c(C(=O)Nc2ccccc2OC)cc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H22N4O3S/c1-3-13-31-23-17(22(29)25-15-9-5-4-6-10-15)14-16(20(24)27-23)21(28)26-18-11-7-8-12-19(18)30-2/h3-12,14H,1,13H2,2H3,(H2,24,27)(H,25,29)(H,26,28) |
| InChIKey | QYGPUMOCVIHYMI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide?
The IUPAC name of 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide (CID 2197130) is 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide.
What is the SMILES notation for 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide?
The canonical SMILES for 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide is C=CCSc1nc(N)c(C(=O)Nc2ccccc2OC)cc1C(=O)Nc1ccccc1.
What is the InChIKey of 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide?
The InChIKey is QYGPUMOCVIHYMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O3S/c1-3-13-31-23-17(22(29)25-15-9-5-4-6-10-15)14-16(20(24)27-23)21(28)26-18-11-7-8-12-19(18)30-2/h3-12,14H,1,13H2,2H3,(H2,24,27)(H,25,29)(H,26,28).
What are the key properties of 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide?
2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide has a molecular weight of 434.52 g/mol, XLogP of 4.46, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-N-(2-methoxyphenyl)-5-N-phenyl-6-prop-2-enylsulfanylpyridine-3,5-dicarboxamide is sourced from PubChem (CID 2197130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).