C24H26O8 — CID 219725
Acetic acid 5'-acetoxy-2,2'-diphenyl-(4,4')bi((1,3)dioxanyl)-5-yl ester (PubChem CID 219725) has the molecular formula C24H26O8 and a molecular weight of 442.50 g/mol. Its IUPAC name is [4-(5-acetyloxy-2-phenyl-1,3-dioxan-4-yl)-2-phenyl-1,3-dioxan-5-yl] acetate.
| Compound Name | Acetic acid 5'-acetoxy-2,2'-diphenyl-(4,4')bi((1,3)dioxanyl)-5-yl ester |
|---|---|
| PubChem CID | 219725 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [4-(5-acetyloxy-2-phenyl-1,3-dioxan-4-yl)-2-phenyl-1,3-dioxan-5-yl] acetate |
| SMILES | CC(=O)OC1COC(OC1C2C(COC(O2)C3=CC=CC=C3)OC(=O)C)C4=CC=CC=C4 |
| InChI | InChI=1S/C24H26O8/c1-15(25)29-19-13-27-23(17-9-5-3-6-10-17)31-21(19)22-20(30-16(2)26)14-28-24(32-22)18-11-7-4-8-12-18/h3-12,19-24H,13-14H2,1-2H3 |
| InChIKey | POIACHWXRFNXHC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | 573 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |