C20H17BrFNO4 — CID 2199045
(4Z)-4-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-2-(4-fluorophenyl)-1,3-oxazol-5-one (PubChem CID 2199045) has the molecular formula C20H17BrFNO4 and a molecular weight of 434.26 g/mol. Its IUPAC name is (4Z)-4-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-2-(4-fluorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-2-(4-fluorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2199045 |
| Molecular Formula | C20H17BrFNO4 |
| Molecular Weight | 434.26 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | (4Z)-4-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-2-(4-fluorophenyl)-1,3-oxazol-5-one |
| SMILES | CCCOc1c(Br)cc(/C=C2\N=C(c3ccc(F)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C20H17BrFNO4/c1-3-8-26-18-15(21)9-12(11-17(18)25-2)10-16-20(24)27-19(23-16)13-4-6-14(22)7-5-13/h4-7,9-11H,3,8H2,1-2H3/b16-10- |
| InChIKey | AZZXKDVXCFNXEL-YBEGLDIGSA-N |
| XLogP | 4.73 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|