About [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate
[[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate (PubChem CID 2199265) has the molecular formula C15H19BrN2O2
and a molecular weight of 339.23 g/mol. Its IUPAC name is [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate.
Molecular Properties
| Compound Name | [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate |
| PubChem CID | 2199265 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate |
| SMILES | NC(=NOC(=O)CCC1CCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H19BrN2O2/c16-13-8-6-12(7-9-13)15(17)18-20-14(19)10-5-11-3-1-2-4-11/h6-9,11H,1-5,10H2,(H2,17,18) |
| InChIKey | XQFVDWRZCXKKQU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate?
The IUPAC name of [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate (CID 2199265) is [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate.
What is the SMILES notation for [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate?
The canonical SMILES for [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate is NC(=NOC(=O)CCC1CCCC1)c1ccc(Br)cc1.
What is the InChIKey of [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate?
The InChIKey is XQFVDWRZCXKKQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrN2O2/c16-13-8-6-12(7-9-13)15(17)18-20-14(19)10-5-11-3-1-2-4-11/h6-9,11H,1-5,10H2,(H2,17,18).
What are the key properties of [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate?
[[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate has a molecular weight of 339.23 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(4-bromophenyl)methylidene]amino] 3-cyclopentylpropanoate is sourced from PubChem (CID 2199265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).