About 10-methylacridin-10-ium
10-methylacridin-10-ium (PubChem CID 22000) has the molecular formula C14H12N+
and a molecular weight of 194.26 g/mol. Its IUPAC name is 10-methylacridin-10-ium.
Molecular Properties
| Compound Name | 10-methylacridin-10-ium |
| PubChem CID | 22000 |
| Molecular Formula | C14H12N+ |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 10-methylacridin-10-ium |
| SMILES | C[n+]1c2ccccc2cc2ccccc21 |
| InChI | InChI=1S/C14H12N/c1-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15/h2-10H,1H3/q+1 |
| InChIKey | GXYLXFITCXXCQV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 10-methylacridin-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylacridin-10-ium?
The IUPAC name of 10-methylacridin-10-ium (CID 22000) is 10-methylacridin-10-ium.
What is the SMILES notation for 10-methylacridin-10-ium?
The canonical SMILES for 10-methylacridin-10-ium is C[n+]1c2ccccc2cc2ccccc21.
What is the InChIKey of 10-methylacridin-10-ium?
The InChIKey is GXYLXFITCXXCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N/c1-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15/h2-10H,1H3/q+1.
What are the key properties of 10-methylacridin-10-ium?
10-methylacridin-10-ium has a molecular weight of 194.26 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylacridin-10-ium is sourced from PubChem (CID 22000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).