About 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine
6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine (PubChem CID 22000088) has the molecular formula C23H15N5
and a molecular weight of 361.41 g/mol. Its IUPAC name is 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine |
| PubChem CID | 22000088 |
| Molecular Formula | C23H15N5 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine |
| SMILES | C#Cc1nc(Nc2ccc3[nH]ccc3c2)c2ccccc2n1.c1cc2nc-2c1 |
| InChI | InChI=1S/C18H12N4.C5H3N/c1-2-17-21-16-6-4-3-5-14(16)18(22-17)20-13-7-8-15-12(11-13)9-10-19-15;1-2-4-5(3-1)6-4/h1,3-11,19H,(H,20,21,22);1-3H |
| InChIKey | XLDIHTRBUVPFIX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine?
The IUPAC name of 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine (CID 22000088) is 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine.
What is the SMILES notation for 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine?
The canonical SMILES for 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine is C#Cc1nc(Nc2ccc3[nH]ccc3c2)c2ccccc2n1.c1cc2nc-2c1.
What is the InChIKey of 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine?
The InChIKey is XLDIHTRBUVPFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N4.C5H3N/c1-2-17-21-16-6-4-3-5-14(16)18(22-17)20-13-7-8-15-12(11-13)9-10-19-15;1-2-4-5(3-1)6-4/h1,3-11,19H,(H,20,21,22);1-3H.
What are the key properties of 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine?
6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine has a molecular weight of 361.41 g/mol, XLogP of 4.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;2-ethynyl-N-(1H-indol-5-yl)quinazolin-4-amine is sourced from PubChem (CID 22000088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).