C21H25F3N2O3 — CID 22000214
3-[3-hydroxy-2-[3-methoxy-6-(trifluoromethyl)-2-pyridinyl]propyl]-2-phenylpiperidin-3-ol (PubChem CID 22000214) has the molecular formula C21H25F3N2O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is 3-[3-hydroxy-2-[3-methoxy-6-(trifluoromethyl)-2-pyridinyl]propyl]-2-phenylpiperidin-3-ol.
| Compound Name | 3-[3-hydroxy-2-[3-methoxy-6-(trifluoromethyl)-2-pyridinyl]propyl]-2-phenylpiperidin-3-ol |
|---|---|
| PubChem CID | 22000214 |
| Molecular Formula | C21H25F3N2O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-[3-hydroxy-2-[3-methoxy-6-(trifluoromethyl)-2-pyridinyl]propyl]-2-phenylpiperidin-3-ol |
| SMILES | COc1ccc(C(F)(F)F)nc1C(CO)CC1(O)CCCNC1c1ccccc1 |
| InChI | InChI=1S/C21H25F3N2O3/c1-29-16-8-9-17(21(22,23)24)26-18(16)15(13-27)12-20(28)10-5-11-25-19(20)14-6-3-2-4-7-14/h2-4,6-9,15,19,25,27-28H,5,10-13H2,1H3 |
| InChIKey | MTPZDJRUKFBVFL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |