About 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine
3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine (PubChem CID 22000220) has the molecular formula C11H6BrF6N3O
and a molecular weight of 390.08 g/mol. Its IUPAC name is 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine.
Molecular Properties
| Compound Name | 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine |
| PubChem CID | 22000220 |
| Molecular Formula | C11H6BrF6N3O |
| Molecular Weight | 390.08 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine |
| SMILES | FC(F)(F)COc1ncc(-n2ccnc2C(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H6BrF6N3O/c12-7-3-6(4-20-8(7)22-5-10(13,14)15)21-2-1-19-9(21)11(16,17)18/h1-4H,5H2 |
| InChIKey | MUBQXYYSLYZVTQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.08 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine?
The IUPAC name of 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine (CID 22000220) is 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine.
What is the SMILES notation for 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine?
The canonical SMILES for 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine is FC(F)(F)COc1ncc(-n2ccnc2C(F)(F)F)cc1Br.
What is the InChIKey of 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine?
The InChIKey is MUBQXYYSLYZVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrF6N3O/c12-7-3-6(4-20-8(7)22-5-10(13,14)15)21-2-1-19-9(21)11(16,17)18/h1-4H,5H2.
What are the key properties of 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine?
3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine has a molecular weight of 390.08 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(2,2,2-trifluoroethoxy)-5-[2-(trifluoromethyl)imidazol-1-yl]pyridine is sourced from PubChem (CID 22000220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).