About (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile
(E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile (PubChem CID 22000587) has the molecular formula C18H14F3NO3S
and a molecular weight of 381.38 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile |
| PubChem CID | 22000587 |
| Molecular Formula | C18H14F3NO3S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)S(=O)(=O)c2ccc(C(F)(F)F)cc2)cc(C)c1O |
| InChI | InChI=1S/C18H14F3NO3S/c1-11-7-13(8-12(2)17(11)23)9-16(10-22)26(24,25)15-5-3-14(4-6-15)18(19,20)21/h3-9,23H,1-2H3/b16-9+ |
| InChIKey | FPOTZFYXZPPAHY-CXUHLZMHSA-N |
| XLogP | 4.37 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile?
The IUPAC name of (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile (CID 22000587) is (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile.
What is the SMILES notation for (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile?
The canonical SMILES for (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile is Cc1cc(/C=C(\C#N)S(=O)(=O)c2ccc(C(F)(F)F)cc2)cc(C)c1O.
What is the InChIKey of (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile?
The InChIKey is FPOTZFYXZPPAHY-CXUHLZMHSA-N. The full InChI is InChI=1S/C18H14F3NO3S/c1-11-7-13(8-12(2)17(11)23)9-16(10-22)26(24,25)15-5-3-14(4-6-15)18(19,20)21/h3-9,23H,1-2H3/b16-9+.
What are the key properties of (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile?
(E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile has a molecular weight of 381.38 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile is sourced from PubChem (CID 22000587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).