C8H15NO3S — CID 22000775
4-(aminomethyl)hepta-1,6-diene-4-sulfonic acid (PubChem CID 22000775) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is 4-(aminomethyl)hepta-1,6-diene-4-sulfonic acid.
| Compound Name | 4-(aminomethyl)hepta-1,6-diene-4-sulfonic acid |
|---|---|
| PubChem CID | 22000775 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 4-(aminomethyl)hepta-1,6-diene-4-sulfonic acid |
| SMILES | C=CCC(CN)(CC=C)S(=O)(=O)O |
| InChI | InChI=1S/C8H15NO3S/c1-3-5-8(7-9,6-4-2)13(10,11)12/h3-4H,1-2,5-7,9H2,(H,10,11,12) |
| InChIKey | FDHYSCDHHYPJAL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|