C25H32N2O6S — CID 22000898
methyl 2-[2-[6-[(E)-[amino(phenyl)methylidene]amino]sulfonyl-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetate (PubChem CID 22000898) has the molecular formula C25H32N2O6S and a molecular weight of 488.61 g/mol. Its IUPAC name is methyl 2-[2-[6-[(E)-[amino(phenyl)methylidene]amino]sulfonyl-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetate.
| Compound Name | methyl 2-[2-[6-[(E)-[amino(phenyl)methylidene]amino]sulfonyl-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 22000898 |
| Molecular Formula | C25H32N2O6S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | methyl 2-[2-[6-[(E)-[amino(phenyl)methylidene]amino]sulfonyl-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetate |
| SMILES | COC(=O)COCCC1(C)CCc2c(C)c(S(=O)(=O)/N=C(/N)c3ccccc3)c(C)c(C)c2O1 |
| InChI | InChI=1S/C25H32N2O6S/c1-16-17(2)23(34(29,30)27-24(26)19-9-7-6-8-10-19)18(3)20-11-12-25(4,33-22(16)20)13-14-32-15-21(28)31-5/h6-10H,11-15H2,1-5H3,(H2,26,27) |
| InChIKey | DQPIARQKRCYGSR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|