C24H30N2O6S — CID 22000910
2-[2-[6-[(E)-[amino(phenyl)methylidene]amino]sulfonyl-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetic acid (PubChem CID 22000910) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-[2-[6-[(E)-[amino(phenyl)methylidene]amino]sulfonyl-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[6-[(E)-[amino(phenyl)methylidene]amino]sulfonyl-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 22000910 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[2-[6-[(E)-[amino(phenyl)methylidene]amino]sulfonyl-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)/N=C(/N)c2ccccc2)c(C)c2c1OC(C)(CCOCC(=O)O)CC2 |
| InChI | InChI=1S/C24H30N2O6S/c1-15-16(2)22(33(29,30)26-23(25)18-8-6-5-7-9-18)17(3)19-10-11-24(4,32-21(15)19)12-13-31-14-20(27)28/h5-9H,10-14H2,1-4H3,(H2,25,26)(H,27,28) |
| InChIKey | XXVVKFYYNQUWKQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|