About 1-isocyanatopyrrole-2,5-dione
1-isocyanatopyrrole-2,5-dione (PubChem CID 22001029) has the molecular formula C5H2N2O3
and a molecular weight of 138.08 g/mol. Its IUPAC name is 1-isocyanatopyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-isocyanatopyrrole-2,5-dione |
| PubChem CID | 22001029 |
| Molecular Formula | C5H2N2O3 |
| Molecular Weight | 138.08 g/mol |
| Exact Mass | 138.01 |
| IUPAC Name | 1-isocyanatopyrrole-2,5-dione |
| SMILES | O=C=NN1C(=O)C=CC1=O |
| InChI | InChI=1S/C5H2N2O3/c8-3-6-7-4(9)1-2-5(7)10/h1-2H |
| InChIKey | OUASETNOWXPIHH-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.08 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanatopyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanatopyrrole-2,5-dione?
The IUPAC name of 1-isocyanatopyrrole-2,5-dione (CID 22001029) is 1-isocyanatopyrrole-2,5-dione.
What is the SMILES notation for 1-isocyanatopyrrole-2,5-dione?
The canonical SMILES for 1-isocyanatopyrrole-2,5-dione is O=C=NN1C(=O)C=CC1=O.
What is the InChIKey of 1-isocyanatopyrrole-2,5-dione?
The InChIKey is OUASETNOWXPIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2N2O3/c8-3-6-7-4(9)1-2-5(7)10/h1-2H.
What are the key properties of 1-isocyanatopyrrole-2,5-dione?
1-isocyanatopyrrole-2,5-dione has a molecular weight of 138.08 g/mol, XLogP of -0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanatopyrrole-2,5-dione is sourced from PubChem (CID 22001029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).