C32H64O12 — CID 22001298
ethyl 9-hydroxy-2,2,7,8,8-pentakis(hydroxymethyl)nonanoate;bis(octanoic acid) (PubChem CID 22001298) has the molecular formula C32H64O12 and a molecular weight of 640.85 g/mol. Its IUPAC name is ethyl 9-hydroxy-2,2,7,8,8-pentakis(hydroxymethyl)nonanoate;bis(octanoic acid).
| Compound Name | ethyl 9-hydroxy-2,2,7,8,8-pentakis(hydroxymethyl)nonanoate;bis(octanoic acid) |
|---|---|
| PubChem CID | 22001298 |
| Molecular Formula | C32H64O12 |
| Molecular Weight | 640.85 g/mol |
| Exact Mass | 640.44 |
| IUPAC Name | ethyl 9-hydroxy-2,2,7,8,8-pentakis(hydroxymethyl)nonanoate;bis(octanoic acid) |
| SMILES | CCCCCCCC(=O)O.CCCCCCCC(=O)O.CCOC(=O)C(CO)(CO)CCCCC(CO)C(CO)(CO)CO |
| InChI | InChI=1S/C16H32O8.2C8H16O2/c1-2-24-14(23)15(8-18,9-19)6-4-3-5-13(7-17)16(10-20,11-21)12-22;2*1-2-3-4-5-6-7-8(9)10/h13,17-22H,2-12H2,1H3;2*2-7H2,1H3,(H,9,10) |
| InChIKey | MKZWQQVOELIJQP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 222.28 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|