C17H20ClNO2 — CID 2200147
N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-2-phenylethanamine (PubChem CID 2200147) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-2-phenylethanamine.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 2200147 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-2-phenylethanamine |
| SMILES | COc1cc(Cl)c(CNCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C17H20ClNO2/c1-20-16-10-14(15(18)11-17(16)21-2)12-19-9-8-13-6-4-3-5-7-13/h3-7,10-11,19H,8-9,12H2,1-2H3 |
| InChIKey | BIMPRWJQIRGKFN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|