About 4-triethoxysilylbutanoic acid
4-triethoxysilylbutanoic acid (PubChem CID 22002212) has the molecular formula C10H22O5Si
and a molecular weight of 250.37 g/mol. Its IUPAC name is 4-triethoxysilylbutanoic acid.
Molecular Properties
| Compound Name | 4-triethoxysilylbutanoic acid |
| PubChem CID | 22002212 |
| Molecular Formula | C10H22O5Si |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-triethoxysilylbutanoic acid |
| SMILES | CCO[Si](CCCC(=O)O)(OCC)OCC |
| InChI | InChI=1S/C10H22O5Si/c1-4-13-16(14-5-2,15-6-3)9-7-8-10(11)12/h4-9H2,1-3H3,(H,11,12) |
| InChIKey | MLTLWTJERLVODH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-triethoxysilylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-triethoxysilylbutanoic acid?
The IUPAC name of 4-triethoxysilylbutanoic acid (CID 22002212) is 4-triethoxysilylbutanoic acid.
What is the SMILES notation for 4-triethoxysilylbutanoic acid?
The canonical SMILES for 4-triethoxysilylbutanoic acid is CCO[Si](CCCC(=O)O)(OCC)OCC.
What is the InChIKey of 4-triethoxysilylbutanoic acid?
The InChIKey is MLTLWTJERLVODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O5Si/c1-4-13-16(14-5-2,15-6-3)9-7-8-10(11)12/h4-9H2,1-3H3,(H,11,12).
What are the key properties of 4-triethoxysilylbutanoic acid?
4-triethoxysilylbutanoic acid has a molecular weight of 250.37 g/mol, XLogP of 1.90, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-triethoxysilylbutanoic acid is sourced from PubChem (CID 22002212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).