About 4-methylsulfanylcyclohexa-2,4-dien-1-imine
4-methylsulfanylcyclohexa-2,4-dien-1-imine (PubChem CID 22002512) has the molecular formula C7H9NS
and a molecular weight of 139.22 g/mol. Its IUPAC name is 4-methylsulfanylcyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 4-methylsulfanylcyclohexa-2,4-dien-1-imine |
| PubChem CID | 22002512 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 4-methylsulfanylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=CC(SC)=CC1 |
| InChI | InChI=1S/C7H9NS/c1-9-7-4-2-6(8)3-5-7/h2,4-5,8H,3H2,1H3/b8-6- |
| InChIKey | VIEROQAQXCOYPV-VURMDHGXSA-N |
| XLogP | 2.21 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfanylcyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanylcyclohexa-2,4-dien-1-imine?
The IUPAC name of 4-methylsulfanylcyclohexa-2,4-dien-1-imine (CID 22002512) is 4-methylsulfanylcyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 4-methylsulfanylcyclohexa-2,4-dien-1-imine?
The canonical SMILES for 4-methylsulfanylcyclohexa-2,4-dien-1-imine is [H]/N=C1/C=CC(SC)=CC1.
What is the InChIKey of 4-methylsulfanylcyclohexa-2,4-dien-1-imine?
The InChIKey is VIEROQAQXCOYPV-VURMDHGXSA-N. The full InChI is InChI=1S/C7H9NS/c1-9-7-4-2-6(8)3-5-7/h2,4-5,8H,3H2,1H3/b8-6-.
What are the key properties of 4-methylsulfanylcyclohexa-2,4-dien-1-imine?
4-methylsulfanylcyclohexa-2,4-dien-1-imine has a molecular weight of 139.22 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanylcyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 22002512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).