About 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium
2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium (PubChem CID 22002625) has the molecular formula C9H18FN2+
and a molecular weight of 173.25 g/mol. Its IUPAC name is 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium |
| PubChem CID | 22002625 |
| Molecular Formula | C9H18FN2+ |
| Molecular Weight | 173.25 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium |
| SMILES | CCCN1CC[N+](CCC)=C1F |
| InChI | InChI=1S/C9H18FN2/c1-3-5-11-7-8-12(6-4-2)9(11)10/h3-8H2,1-2H3/q+1 |
| InChIKey | GMXZRYLTWGGLOE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium?
The IUPAC name of 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium (CID 22002625) is 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium.
What is the SMILES notation for 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium?
The canonical SMILES for 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium is CCCN1CC[N+](CCC)=C1F.
What is the InChIKey of 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium?
The InChIKey is GMXZRYLTWGGLOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FN2/c1-3-5-11-7-8-12(6-4-2)9(11)10/h3-8H2,1-2H3/q+1.
What are the key properties of 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium?
2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium has a molecular weight of 173.25 g/mol, XLogP of 1.46, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,3-dipropyl-4,5-dihydroimidazol-1-ium is sourced from PubChem (CID 22002625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).