About 2-iodo-4,4-dimethylcyclopent-2-en-1-one
2-iodo-4,4-dimethylcyclopent-2-en-1-one (PubChem CID 22002644) has the molecular formula C7H9IO
and a molecular weight of 236.05 g/mol. Its IUPAC name is 2-iodo-4,4-dimethylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 2-iodo-4,4-dimethylcyclopent-2-en-1-one |
| PubChem CID | 22002644 |
| Molecular Formula | C7H9IO |
| Molecular Weight | 236.05 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 2-iodo-4,4-dimethylcyclopent-2-en-1-one |
| SMILES | CC1(C)C=C(I)C(=O)C1 |
| InChI | InChI=1S/C7H9IO/c1-7(2)3-5(8)6(9)4-7/h3H,4H2,1-2H3 |
| InChIKey | QKVAZBBWIBEJHK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.05 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-4,4-dimethylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-4,4-dimethylcyclopent-2-en-1-one?
The IUPAC name of 2-iodo-4,4-dimethylcyclopent-2-en-1-one (CID 22002644) is 2-iodo-4,4-dimethylcyclopent-2-en-1-one.
What is the SMILES notation for 2-iodo-4,4-dimethylcyclopent-2-en-1-one?
The canonical SMILES for 2-iodo-4,4-dimethylcyclopent-2-en-1-one is CC1(C)C=C(I)C(=O)C1.
What is the InChIKey of 2-iodo-4,4-dimethylcyclopent-2-en-1-one?
The InChIKey is QKVAZBBWIBEJHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9IO/c1-7(2)3-5(8)6(9)4-7/h3H,4H2,1-2H3.
What are the key properties of 2-iodo-4,4-dimethylcyclopent-2-en-1-one?
2-iodo-4,4-dimethylcyclopent-2-en-1-one has a molecular weight of 236.05 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-4,4-dimethylcyclopent-2-en-1-one is sourced from PubChem (CID 22002644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).