C5H4Cl3F7Si — CID 22002749
trichloro(3,3,4,4,5,5,5-heptafluoropentyl)silane (PubChem CID 22002749) has the molecular formula C5H4Cl3F7Si and a molecular weight of 331.52 g/mol. Its IUPAC name is trichloro(3,3,4,4,5,5,5-heptafluoropentyl)silane.
| Compound Name | trichloro(3,3,4,4,5,5,5-heptafluoropentyl)silane |
|---|---|
| PubChem CID | 22002749 |
| Molecular Formula | C5H4Cl3F7Si |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 329.90 |
| IUPAC Name | trichloro(3,3,4,4,5,5,5-heptafluoropentyl)silane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C5H4Cl3F7Si/c6-16(7,8)2-1-3(9,10)4(11,12)5(13,14)15/h1-2H2 |
| InChIKey | HPQDRJIVNDILHK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|