About [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate
[2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate (PubChem CID 22002762) has the molecular formula C17H28O4
and a molecular weight of 296.41 g/mol. Its IUPAC name is [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate |
| PubChem CID | 22002762 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC)C(C)(OC(=O)C(=C)C)C(C)C |
| InChI | InChI=1S/C17H28O4/c1-9-10-14(20-15(18)11(2)3)17(8,13(6)7)21-16(19)12(4)5/h13-14H,2,4,9-10H2,1,3,5-8H3 |
| InChIKey | QBQVLRSZKJYBBJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate?
The IUPAC name of [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate (CID 22002762) is [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate?
The canonical SMILES for [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC(CCC)C(C)(OC(=O)C(=C)C)C(C)C.
What is the InChIKey of [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate?
The InChIKey is QBQVLRSZKJYBBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O4/c1-9-10-14(20-15(18)11(2)3)17(8,13(6)7)21-16(19)12(4)5/h13-14H,2,4,9-10H2,1,3,5-8H3.
What are the key properties of [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate?
[2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate has a molecular weight of 296.41 g/mol, XLogP of 3.81, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dimethyl-3-(2-methylprop-2-enoyloxy)heptan-4-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 22002762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).