About 3-(pentoxymethyl)pentane
3-(pentoxymethyl)pentane (PubChem CID 22002797) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is 3-(pentoxymethyl)pentane.
Molecular Properties
| Compound Name | 3-(pentoxymethyl)pentane |
| PubChem CID | 22002797 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 3-(pentoxymethyl)pentane |
| SMILES | CCCCCOCC(CC)CC |
| InChI | InChI=1S/C11H24O/c1-4-7-8-9-12-10-11(5-2)6-3/h11H,4-10H2,1-3H3 |
| InChIKey | NSAGUZAIKCLTSS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(pentoxymethyl)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(pentoxymethyl)pentane?
The IUPAC name of 3-(pentoxymethyl)pentane (CID 22002797) is 3-(pentoxymethyl)pentane.
What is the SMILES notation for 3-(pentoxymethyl)pentane?
The canonical SMILES for 3-(pentoxymethyl)pentane is CCCCCOCC(CC)CC.
What is the InChIKey of 3-(pentoxymethyl)pentane?
The InChIKey is NSAGUZAIKCLTSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O/c1-4-7-8-9-12-10-11(5-2)6-3/h11H,4-10H2,1-3H3.
What are the key properties of 3-(pentoxymethyl)pentane?
3-(pentoxymethyl)pentane has a molecular weight of 172.31 g/mol, XLogP of 3.63, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(pentoxymethyl)pentane is sourced from PubChem (CID 22002797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).