C14H15F3O5S — CID 22002835
ethyl 6-(trifluoromethylsulfonyloxy)-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 22002835) has the molecular formula C14H15F3O5S and a molecular weight of 352.33 g/mol. Its IUPAC name is ethyl 6-(trifluoromethylsulfonyloxy)-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | ethyl 6-(trifluoromethylsulfonyloxy)-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 22002835 |
| Molecular Formula | C14H15F3O5S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | ethyl 6-(trifluoromethylsulfonyloxy)-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)C1CCc2cc(OS(=O)(=O)C(F)(F)F)ccc2C1 |
| InChI | InChI=1S/C14H15F3O5S/c1-2-21-13(18)11-4-3-10-8-12(6-5-9(10)7-11)22-23(19,20)14(15,16)17/h5-6,8,11H,2-4,7H2,1H3 |
| InChIKey | AAKYUAODOPKQGV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|