C11H16O2 — CID 22003323
2-[1-(5-methylcyclopenta-1,4-dien-1-yl)ethoxymethyl]oxirane (PubChem CID 22003323) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[1-(5-methylcyclopenta-1,4-dien-1-yl)ethoxymethyl]oxirane.
| Compound Name | 2-[1-(5-methylcyclopenta-1,4-dien-1-yl)ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 22003323 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-[1-(5-methylcyclopenta-1,4-dien-1-yl)ethoxymethyl]oxirane |
| SMILES | CC1=CCC=C1C(C)OCC1CO1 |
| InChI | InChI=1S/C11H16O2/c1-8-4-3-5-11(8)9(2)12-6-10-7-13-10/h4-5,9-10H,3,6-7H2,1-2H3 |
| InChIKey | XBENEJJYIOJSIW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|