C14H2F12O2 — CID 22003363
2,3,5,6-tetrafluoro-4-[1,2,2,2-tetrafluoro-1-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)ethyl]phenol (PubChem CID 22003363) has the molecular formula C14H2F12O2 and a molecular weight of 430.14 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[1,2,2,2-tetrafluoro-1-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)ethyl]phenol.
| Compound Name | 2,3,5,6-tetrafluoro-4-[1,2,2,2-tetrafluoro-1-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 22003363 |
| Molecular Formula | C14H2F12O2 |
| Molecular Weight | 430.14 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[1,2,2,2-tetrafluoro-1-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)ethyl]phenol |
| SMILES | Oc1c(F)c(F)c(C(F)(c2c(F)c(F)c(O)c(F)c2F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14H2F12O2/c15-3-1(4(16)8(20)11(27)7(3)19)13(23,14(24,25)26)2-5(17)9(21)12(28)10(22)6(2)18/h27-28H |
| InChIKey | WSFHXEDYNPXQBV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.14 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|