C18H14ClF5N2O — CID 2200338
N-(3-chloro-4-piperidin-1-ylphenyl)-2,3,4,5,6-pentafluorobenzamide (PubChem CID 2200338) has the molecular formula C18H14ClF5N2O and a molecular weight of 404.77 g/mol. Its IUPAC name is N-(3-chloro-4-piperidin-1-ylphenyl)-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(3-chloro-4-piperidin-1-ylphenyl)-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 2200338 |
| Molecular Formula | C18H14ClF5N2O |
| Molecular Weight | 404.77 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-(3-chloro-4-piperidin-1-ylphenyl)-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(Cl)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H14ClF5N2O/c19-10-8-9(4-5-11(10)26-6-2-1-3-7-26)25-18(27)12-13(20)15(22)17(24)16(23)14(12)21/h4-5,8H,1-3,6-7H2,(H,25,27) |
| InChIKey | KQTQNHBBDKCZKL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.77 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|