C18H18ClF4N3O4 — CID 22003549
diethylamino 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate (PubChem CID 22003549) has the molecular formula C18H18ClF4N3O4 and a molecular weight of 451.80 g/mol. Its IUPAC name is diethylamino 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate.
| Compound Name | diethylamino 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 22003549 |
| Molecular Formula | C18H18ClF4N3O4 |
| Molecular Weight | 451.80 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | diethylamino 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate |
| SMILES | CCN(CC)OC(=O)COc1cc(-n2ncc(C(F)(F)F)c(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C18H18ClF4N3O4/c1-4-25(5-2)30-16(27)9-29-15-7-14(13(20)6-12(15)19)26-17(28)10(3)11(8-24-26)18(21,22)23/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | BCBZDNPDMRXUSP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|