About 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide
3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide (PubChem CID 22004301) has the molecular formula C13H14F2N2O3
and a molecular weight of 284.26 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide.
Molecular Properties
| Compound Name | 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide |
| PubChem CID | 22004301 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide |
| SMILES | CC1(C)OCC(=O)NC1(C(N)=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H14F2N2O3/c1-12(2)13(11(16)19,17-10(18)6-20-12)7-3-4-8(14)9(15)5-7/h3-5H,6H2,1-2H3,(H2,16,19)(H,17,18) |
| InChIKey | OSWQKMVBKLDROM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide?
The IUPAC name of 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide (CID 22004301) is 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide.
What is the SMILES notation for 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide?
The canonical SMILES for 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide is CC1(C)OCC(=O)NC1(C(N)=O)c1ccc(F)c(F)c1.
What is the InChIKey of 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide?
The InChIKey is OSWQKMVBKLDROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O3/c1-12(2)13(11(16)19,17-10(18)6-20-12)7-3-4-8(14)9(15)5-7/h3-5H,6H2,1-2H3,(H2,16,19)(H,17,18).
What are the key properties of 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide?
3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide has a molecular weight of 284.26 g/mol, XLogP of 0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenyl)-2,2-dimethyl-5-oxomorpholine-3-carboxamide is sourced from PubChem (CID 22004301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).