C27H36N2O5S — CID 22004703
N-[2-butan-2-yl-3-[4-[3-(butylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide (PubChem CID 22004703) has the molecular formula C27H36N2O5S and a molecular weight of 500.66 g/mol. Its IUPAC name is N-[2-butan-2-yl-3-[4-[3-(butylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide.
| Compound Name | N-[2-butan-2-yl-3-[4-[3-(butylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 22004703 |
| Molecular Formula | C27H36N2O5S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | N-[2-butan-2-yl-3-[4-[3-(butylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide |
| SMILES | CCCCNCCCOc1ccc(C(=O)c2c(C(C)CC)oc3ccc(NS(C)(=O)=O)cc23)cc1 |
| InChI | InChI=1S/C27H36N2O5S/c1-5-7-15-28-16-8-17-33-22-12-9-20(10-13-22)26(30)25-23-18-21(29-35(4,31)32)11-14-24(23)34-27(25)19(3)6-2/h9-14,18-19,28-29H,5-8,15-17H2,1-4H3 |
| InChIKey | XJODRVZNRVXTSL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|